![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Pachchis (2021) (Hin..> | 2025-09-12 06:27 | - | |
| Savage Salvation/ | 2025-09-12 06:28 | - | |
| Selfless/ | 2025-09-12 06:28 | - | |
| Seoul Vibe/ | 2025-09-12 06:28 | - | |
| Shadow Master/ | 2025-09-12 06:29 | - | |
| Sinam/ | 2025-09-12 06:29 | - | |
| Soldiers of the Damned/ | 2025-09-12 06:29 | - | |
| Southpaw/ | 2025-09-12 06:30 | - | |
| Spectre/ | 2025-09-12 06:30 | - | |
| Spy/ | 2025-09-12 06:33 | - | |
| Spy Time/ | 2025-09-12 06:33 | - | |
| Star Wars Episode VI..> | 2025-09-12 06:34 | - | |
| Starship Apocalypse/ | 2025-09-12 06:34 | - | |
| Stealing Raden Saleh/ | 2025-09-12 06:34 | - | |
| Stormageddon/ | 2025-09-12 06:35 | - | |
| Strayers Chronicle/ | 2025-09-12 06:35 | - | |
| Street/ | 2025-09-12 06:37 | - | |
| Stunt Driver/ | 2025-09-12 06:38 | - | |
| Subconscious/ | 2025-09-12 06:38 | - | |
| SuperBob/ | 2025-09-12 06:39 | - | |
| Superfast/ | 2025-09-12 06:40 | - | |
| Survivor/ | 2025-09-12 06:40 | - | |
| Taken 3/ | 2025-09-12 06:42 | - | |
| Terminator Genisys/ | 2025-09-12 06:42 | - | |
| Thallumaala/ | 2025-09-12 06:42 | - | |
| The Answer/ | 2025-09-12 06:44 | - | |
| The Big Four/ | 2025-09-12 06:44 | - | |
| The Demolisher/ | 2025-09-12 06:45 | - | |
| The Drug King/ | 2025-09-12 06:45 | - | |
| The Eight Hundred/ | 2025-09-12 06:46 | - | |
| The Enforcer/ | 2025-09-12 06:46 | - | |
| The Fable The Killer..> | 2025-09-12 06:47 | - | |
| The Glorious Seven/ | 2025-09-12 06:47 | - | |
| The Golden Holiday/ | 2025-09-12 06:48 | - | |
| The Good The Bad The..> | 2025-09-12 06:48 | - | |
| The Gunman/ | 2025-09-12 06:49 | - | |
| The Hard Way/ | 2025-09-12 06:49 | - | |
| The Humanity Bureau/ | 2025-09-12 06:50 | - | |
| The Hunger Games Moc..> | 2025-09-12 06:50 | - | |
| The Kid/ | 2025-09-12 06:51 | - | |
| The Last Rescue/ | 2025-09-12 06:51 | - | |
| The Last Runway/ | 2025-09-12 06:52 | - | |
| The Last Sharknado_ ..> | 2025-09-12 06:53 | - | |
| The Last Whistle/ | 2025-09-12 06:53 | - | |
| The Last Witch Hunter/ | 2025-09-12 06:54 | - | |
| The Liberator/ | 2025-09-12 06:55 | - | |
| The Lotus/ | 2025-09-12 06:55 | - | |
| The Lovers/ | 2025-09-12 06:56 | - | |
| The Man From Nowhere/ | 2025-09-12 06:56 | - | |
| The Man from U.N.C.L.E/ | 2025-09-12 06:57 | - | |
| The Man with the Iro..> | 2025-09-12 06:57 | - | |
| The Marine 4 Moving ..> | 2025-09-12 06:58 | - | |
| The Marine 5 Battle..> | 2025-09-12 06:58 | - | |
| The Meg/ | 2025-09-12 07:00 | - | |
| The Merciless/ | 2025-09-12 07:00 | - | |
| The Minds Eye/ | 2025-09-12 07:00 | - | |
| The Monster Project/ | 2025-09-12 07:01 | - | |
| The Mumbai Siege 4 D..> | 2025-09-12 07:02 | - | |
| The Mummy/ | 2025-09-12 07:06 | - | |
| The Night Comes For Us/ | 2025-09-12 07:06 | - | |
| The OctoGames/ | 2025-09-12 07:07 | - | |
| The Outer Wild/ | 2025-09-12 07:07 | - | |
| The Outlaws/ | 2025-09-12 07:07 | - | |
| The Pirates The Last..> | 2025-09-12 07:08 | - | |
| The Predator/ | 2025-09-12 07:09 | - | |
| The Quake/ | 2025-09-12 07:09 | - | |
| The Rizen/ | 2025-09-12 07:10 | - | |
| The Runner/ | 2025-09-12 07:11 | - | |
| The Saint/ | 2025-09-12 07:11 | - | |
| The Second/ | 2025-09-12 07:12 | - | |
| The Secret Reunion/ | 2025-09-12 07:13 | - | |
| The Shadow Effect/ | 2025-09-12 07:13 | - | |
| The Shanghai Job/ | 2025-09-12 07:13 | - | |
| The Spy Who Dumped Me/ | 2025-09-12 07:15 | - | |
| The Stolen/ | 2025-09-12 07:16 | - | |
| The Swindlers/ | 2025-09-12 07:17 | - | |
| The Swordsman/ | 2025-09-12 07:17 | - | |
| The System/ | 2025-09-12 07:17 | - | |
| The Throwaways/ | 2025-09-12 07:17 | - | |
| The Tiger An Old Hun..> | 2025-09-12 07:18 | - | |
| The Transporter Refu..> | 2025-09-12 07:18 | - | |
| The Unseen/ | 2025-09-12 07:19 | - | |
| The Villainess/ | 2025-09-12 07:22 | - | |
| The Warrior/ | 2025-09-12 07:23 | - | |
| The Warriorr/ | 2025-09-12 07:25 | - | |
| The Wolf's Call/ | 2025-09-12 07:25 | - | |
| The Yin-Yang Master ..> | 2025-09-12 07:26 | - | |
| There Are No Saints/ | 2025-09-12 07:26 | - | |
| The villain/ | 2025-09-12 07:21 | - | |
| Thor/ | 2025-09-12 07:27 | - | |
| Thor Ragnarok/ | 2025-09-12 07:27 | - | |
| Through the Ashes/ | 2025-09-12 07:30 | - | |
| Tiger House/ | 2025-09-12 07:30 | - | |
| Tokyo Ghoul/ | 2025-09-12 07:31 | - | |
| Tomb Invader/ | 2025-09-12 07:32 | - | |
| Tomb Raider/ | 2025-09-12 07:32 | - | |
| Tooken/ | 2025-09-12 07:33 | - | |
| Topgun/ | 2025-09-12 07:33 | - | |
| Tracers/ | 2025-09-12 07:34 | - | |
| Trading Paint/ | 2025-09-12 07:36 | - | |
| Tremors 5 Bloodlines/ | 2025-09-12 07:36 | - | |
| Triassic World/ | 2025-09-12 07:37 | - | |
| Triple Frontier/ | 2025-09-12 07:37 | - | |
| Triple Threat/ | 2025-09-12 07:39 | - | |
| Troll/ | 2025-09-12 07:39 | - | |
| Trust No 1/ | 2025-09-12 07:40 | - | |
| Turbo Kid/ | 2025-09-12 07:40 | - | |
| UFO/ | 2025-09-12 07:43 | - | |
| Underdog Kids/ | 2025-09-12 07:44 | - | |
| Uniki/ | 2025-09-12 07:44 | - | |