![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[DIR]](/icons/bomb.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 2.0/ | 2025-09-12 01:22 | - | |
| 6-Headed Shark Attack/ | 2025-09-12 01:24 | - | |
| 12 Strong/ | 2025-09-12 01:21 | - | |
| 22 Chaser/ | 2025-09-12 01:23 | - | |
| 211/ | 2025-09-12 01:23 | - | |
| A. I. Tales/ | 2025-09-12 01:25 | - | |
| A Better Tomorrow 2018/ | 2025-09-12 01:25 | - | |
| Accident Man/ | 2025-09-12 01:26 | - | |
| Acts of Violence/ | 2025-09-12 01:27 | - | |
| Agenda_ Payback/ | 2025-09-12 01:27 | - | |
| Agent Mr. Chan/ | 2025-09-12 01:28 | - | |
| Air Strike/ | 2025-09-12 01:29 | - | |
| Aiyaary/ | 2025-09-12 01:29 | - | |
| Along With The Gods ..> | 2025-09-12 01:30 | - | |
| Amazon Hot Box/ | 2025-09-12 01:31 | - | |
| Animal World/ | 2025-09-12 01:32 | - | |
| Ant-Man And The Wasp/ | 2025-09-12 01:33 | - | |
| Antidote/ | 2025-09-12 01:34 | - | |
| Apocalypse Rising/ | 2025-09-12 01:34 | - | |
| Aquaman/ | 2025-09-12 01:37 | - | |
| Armed/ | 2025-09-12 01:37 | - | |
| Asher/ | 2025-09-12 01:38 | - | |
| Astro/ | 2025-09-12 01:39 | - | |
| Attrition/ | 2025-09-12 01:40 | - | |
| Avengers_ Infinity War/ | 2025-09-12 01:40 | - | |
| Baaghi 2/ | 2025-09-12 01:42 | - | |
| Babes With Blades/ | 2025-09-12 01:42 | - | |
| Beast of Burden/ | 2025-09-12 01:43 | - | |
| Beirut/ | 2025-09-12 01:44 | - | |
| Betrayed/ | 2025-09-12 01:44 | - | |
| Between Worlds/ | 2025-09-12 01:44 | - | |
| Beyond The Edge/ | 2025-09-12 01:46 | - | |
| Bhavesh Joshi Superh..> | 2025-09-12 01:46 | - | |
| Big Brother/ | 2025-09-12 01:47 | - | |
| Big Legend/ | 2025-09-12 01:47 | - | |
| Black Panther/ | 2025-09-12 01:49 | - | |
| Black Site/ | 2025-09-12 01:50 | - | |
| Black Water/ | 2025-09-12 01:51 | - | |
| Blue Iguana/ | 2025-09-12 01:51 | - | |
| Book of Monsters/ | 2025-09-12 01:51 | - | |
| Braven/ | 2025-09-12 01:52 | - | |
| Breaking & Exiting/ | 2025-09-12 01:53 | - | |
| Buffalo Boys/ | 2025-09-12 01:54 | - | |
| Bumblebee/ | 2025-09-12 01:55 | - | |
| Commando Ninja/ | 2025-09-12 01:55 | - | |
| Corbin Nash/ | 2025-09-12 01:55 | - | |
| Danger One/ | 2025-09-12 01:57 | - | |
| Daphne & Velma/ | 2025-09-12 01:57 | - | |
| Darc/ | 2025-09-12 01:57 | - | |
| Days Of Power/ | 2025-09-12 01:59 | - | |
| Dead Ringer/ | 2025-09-12 01:59 | - | |
| Deadpool 2/ | 2025-09-12 02:00 | - | |
| Death Kiss/ | 2025-09-12 02:01 | - | |
| Death Wish/ | 2025-09-12 02:01 | - | |
| Deep Blue Sea 2/ | 2025-09-12 02:02 | - | |
| Den Of Thieves/ | 2025-09-12 02:02 | - | |
| Destroyer/ | 2025-09-12 02:04 | - | |
| Detective Dee The Fo..> | 2025-09-12 02:04 | - | |
| Dirty Dead Con Men/ | 2025-09-12 02:05 | - | |
| Distorted/ | 2025-09-12 02:05 | - | |
| Dragged Across Concr..> | 2025-09-12 02:05 | - | |
| Edge of Fear/ | 2025-09-12 02:07 | - | |
| Extinction/ | 2025-09-12 02:08 | - | |
| Fat Buddies/ | 2025-09-12 02:09 | - | |
| Final Score/ | 2025-09-12 02:09 | - | |
| Fury of the Fist and..> | 2025-09-12 02:11 | - | |
| Game Over, Man!/ | 2025-09-12 02:11 | - | |
| Golden Job/ | 2025-09-12 02:12 | - | |
| Gringo/ | 2025-09-12 02:12 | - | |
| Higher Power/ | 2025-09-12 02:13 | - | |
| Honor Up/ | 2025-09-12 02:14 | - | |
| Hotel Artemis/ | 2025-09-12 02:15 | - | |
| How It Ends/ | 2025-09-12 02:16 | - | |
| Hunter Killer/ | 2025-09-12 02:16 | - | |
| I Am Vengeance/ | 2025-09-12 02:17 | - | |
| Iceman The Time Trav..> | 2025-09-12 02:18 | - | |
| Illang The Wolf Brig..> | 2025-09-12 02:18 | - | |
| Incoming/ | 2025-09-12 02:19 | - | |
| Intensive Care/ | 2025-09-12 02:20 | - | |
| Inuyashiki/ | 2025-09-12 02:21 | - | |
| Johnny English Strik..> | 2025-09-12 02:22 | - | |
| Jurassic Predator/ | 2025-09-12 02:22 | - | |
| K.G.F Chapter 1/ | 2025-09-12 02:23 | - | |
| Keep Calm and Be a S..> | 2025-09-12 02:23 | - | |
| Killing Joan/ | 2025-09-12 02:24 | - | |
| Kin/ | 2025-09-12 02:25 | - | |
| L/ | 2025-09-12 02:25 | - | |
| Lake Placid_ Legacy/ | 2025-09-12 02:27 | - | |
| Loss Prevention/ | 2025-09-12 02:28 | - | |
| Mandy/ | 2025-09-12 02:29 | - | |
| Mard Ko Dard Nahin H..> | 2025-09-12 02:31 | - | |
| Master Z The Ip Man ..> | 2025-09-12 02:31 | - | |
| Maze Runner_ The Dea..> | 2025-09-12 02:31 | - | |
| Megalodon/ | 2025-09-12 02:32 | - | |
| Mile 22/ | 2025-09-12 02:33 | - | |
| Minutes To Midnight/ | 2025-09-12 02:35 | - | |
| Nazi Overlord/ | 2025-09-12 02:35 | - | |
| Ocean's Eight/ | 2025-09-12 02:35 | - | |
| October/ | 2025-09-12 02:37 | - | |
| Office Uprising/ | 2025-09-12 02:37 | - | |
| Omerta/ | 2025-09-12 02:40 | - | |
| Operation Red Sea/ | 2025-09-12 02:40 | - | |
| Outlaw King/ | 2025-09-12 02:42 | - | |
| Outlawed/ | 2025-09-12 02:42 | - | |
| Over Drive/ | 2025-09-12 02:44 | - | |
| Parmanu_ The Story o..> | 2025-09-12 02:44 | - | |
| Pataakha/ | 2025-09-12 02:45 | - | |
| Peppermint/ | 2025-09-12 02:45 | - | |
| Pitbull_ Last Dog/ | 2025-09-12 02:46 | - | |
| Proud Mary/ | 2025-09-12 02:46 | - | |
| Raazi/ | 2025-09-12 02:47 | - | |
| Race 3/ | 2025-09-12 02:49 | - | |
| Raid/ | 2025-09-12 02:49 | - | |
| Rampage/ | 2025-09-12 02:50 | - | |
| Rampant/ | 2025-09-12 02:51 | - | |
| Ray & Liz/ | 2025-09-12 02:51 | - | |
| Ready Player One/ | 2025-09-12 02:52 | - | |
| Red Army Hooligans/ | 2025-09-12 02:52 | - | |
| Reprisal/ | 2025-09-12 02:53 | - | |
| Robin Hood/ | 2025-09-12 02:54 | - | |
| Saheb Biwi Aur Gangs..> | 2025-09-12 02:55 | - | |
| Samson/ | 2025-09-12 02:56 | - | |
| Satyameva Jayate/ | 2025-09-12 02:56 | - | |
| Scorched Earth/ | 2025-09-12 02:57 | - | |
| Shifting Gears/ | 2025-09-12 02:58 | - | |
| Sicario_ Day of the ..> | 2025-09-12 02:59 | - | |
| Silencer/ | 2025-09-12 02:59 | - | |
| Simmba/ | 2025-09-12 03:01 | - | |
| Sketch/ | 2025-09-12 03:01 | - | |
| Skif/ | 2025-09-12 03:08 | - | |
| Snatch Up/ | 2025-09-12 03:08 | - | |
| Solis/ | 2025-09-12 03:08 | - | |
| Subedar Joginder Singh/ | 2025-09-12 03:09 | - | |
| SuperFly/ | 2025-09-12 03:09 | - | |
| T-34/ | 2025-09-12 03:10 | - | |
| Tag/ | 2025-09-12 03:12 | - | |
| Take Point/ | 2025-09-12 03:12 | - | |
| Tanki/ | 2025-09-12 03:13 | - | |
| The Angel/ | 2025-09-12 03:13 | - | |
| The Assassin's Code/ | 2025-09-12 03:14 | - | |
| The Bouncer/ | 2025-09-12 03:15 | - | |
| The Cloverfield Para..> | 2025-09-12 03:15 | - | |
| The Commuter/ | 2025-09-12 03:16 | - | |
| The Dark/ | 2025-09-12 03:17 | - | |
| The Darkest Minds/ | 2025-09-12 03:17 | - | |
| The Death of Superman/ | 2025-09-12 03:19 | - | |
| The Debt Collector/ | 2025-09-12 03:19 | - | |
| The Drug King/ | 2025-09-12 03:19 | - | |
| The First Purge/ | 2025-09-12 03:20 | - | |
| The Girl in the Spid..> | 2025-09-12 03:21 | - | |
| The Happytime Murders/ | 2025-09-12 03:21 | - | |
| The Hurricane Heist/ | 2025-09-12 03:22 | - | |
| The Last Runway/ | 2025-09-12 03:23 | - | |
| The Last Sharknado_ ..> | 2025-09-12 03:24 | - | |
| The Legend of Hallow..> | 2025-09-12 03:24 | - | |
| The Lotus/ | 2025-09-12 03:25 | - | |
| The Meg/ | 2025-09-12 03:27 | - | |
| The Night Comes For Us/ | 2025-09-12 03:27 | - | |
| The Outer Wild/ | 2025-09-12 03:28 | - | |
| The Predator/ | 2025-09-12 03:29 | - | |
| The Quake/ | 2025-09-12 03:29 | - | |
| The Second/ | 2025-09-12 03:30 | - | |
| The Spy Who Dumped Me/ | 2025-09-12 03:32 | - | |
| The Wind Guardians/ | 2025-09-12 03:32 | - | |
| Thugs of Hindostan/ | 2025-09-12 03:32 | - | |
| Tomb Invader/ | 2025-09-12 03:33 | - | |
| Tomb Raider/ | 2025-09-12 03:34 | - | |
| Triassic World/ | 2025-09-12 03:35 | - | |
| UFO/ | 2025-09-12 03:35 | - | |
| Upgrade/ | 2025-09-12 03:36 | - | |
| Venom/ | 2025-09-12 03:36 | - | |
| War Raiders/ | 2025-09-12 03:37 | - | |
| Warfighter/ | 2025-09-12 03:37 | - | |
| Wastelander/ | 2025-09-12 03:39 | - | |
| Women of Mafia/ | 2025-09-12 03:39 | - | |
| Wunderland/ | 2025-09-12 03:40 | - | |
| X Zone/ | 2025-09-12 03:41 | - | |
| Zero/ | 2025-09-12 03:41 | - | |
| Zombies/ | 2025-09-12 03:42 | - | |