![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 5d565fc2-ee32-4532-b..> | 2023-08-10 19:30 | 79K | |
| Aadhi Bhagavan/ | 2025-09-11 19:43 | - | |
| Alex Pandian/ | 2025-09-11 19:44 | - | |
| Atharintiki Daaredi/ | 2025-09-11 19:44 | - | |
| Aurangzeb/ | 2025-09-11 19:45 | - | |
| B A Pass/ | 2025-09-11 19:45 | - | |
| Baadshah/ | 2025-09-11 19:46 | - | |
| Balupu/ | 2025-09-11 19:47 | - | |
| Batman The Dark Knig..> | 2025-09-11 19:47 | - | |
| Bayonetta- Bloody Fate/ | 2025-09-11 19:48 | - | |
| Biriyani/ | 2025-09-11 19:48 | - | |
| Bullet Raja/ | 2025-09-11 19:49 | - | |
| Cold Eyes/ | 2025-09-11 19:50 | - | |
| D-Day -/ | 2025-09-11 19:52 | - | |
| David/ | 2025-09-11 19:52 | - | |
| Death Race 3/ | 2025-09-11 19:53 | - | |
| Enemmy/ | 2025-09-11 19:54 | - | |
| Flu/ | 2025-09-11 19:55 | - | |
| Gangster Squad/ | 2025-09-11 19:55 | - | |
| Himmatwala/ | 2025-09-11 19:57 | - | |
| Iddarammayilatho/ | 2025-09-11 19:57 | - | |
| Jayantabhai Ki Luv S..> | 2025-09-11 19:59 | - | |
| Kammath & Kammath/ | 2025-09-11 19:59 | - | |
| Kanamachi/ | 2025-09-11 19:59 | - | |
| Krrish 3/ | 2025-09-11 20:00 | - | |
| Mariyaan/ | 2025-09-11 20:00 | - | |
| Mirchi/ | 2025-09-11 20:01 | - | |
| Mr. Go/ | 2025-09-11 20:01 | - | |
| Mumbai Mirror/ | 2025-09-11 20:01 | - | |
| Naayak/ | 2025-09-11 20:01 | - | |
| Om 3D/ | 2025-09-11 20:02 | - | |
| Ongole Gitta/ | 2025-09-11 20:03 | - | |
| Pandiya Naadu/ | 2025-09-11 20:03 | - | |
| Pattathu Yaanai/ | 2025-09-11 20:03 | - | |
| Policegiri/ | 2025-09-11 20:05 | - | |
| R..Rajkumar/ | 2025-09-11 20:05 | - | |
| Rajdhani Express/ | 2025-09-11 20:05 | - | |
| Ramaiya Vastavaiya/ | 2025-09-11 20:06 | - | |
| Ramayya Vasthavayya/ | 2025-09-11 20:06 | - | |
| Rush/ | 2025-09-11 20:07 | - | |
| Saheb Biwi Aur Gangs..> | 2025-09-11 20:07 | - | |
| Singam 2/ | 2025-09-11 20:09 | - | |
| Singh Saab The Great/ | 2025-09-11 20:09 | - | |
| Singh vs Kaur/ | 2025-09-11 20:10 | - | |
| The Attacks of 26 11/ | 2025-09-11 20:11 | - | |
| The Hobbit The Desol..> | 2025-09-11 20:12 | - | |
| Vathikuchi/ | 2025-09-11 20:12 | - | |
| Yamla Pagla Deewana 2/ | 2025-09-11 20:12 | - | |
| Zanjeer/ | 2025-09-11 20:13 | - | |